C23H24N4O4 — CID 71520101
N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[methyl(pyridin-4-yl)amino]benzamide (PubChem CID 71520101) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[methyl(pyridin-4-yl)amino]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[methyl(pyridin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 71520101 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]-4-[methyl(pyridin-4-yl)amino]benzamide |
| SMILES | CN(c1ccncc1)c1ccc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)C[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H24N4O4/c1-26(20-11-13-24-14-12-20)19-9-7-18(8-10-19)23(29)25-21(22(28)16-27(30)31)15-17-5-3-2-4-6-17/h2-14,21-22,28H,15-16H2,1H3,(H,25,29)/t21-,22+/m0/s1 |
| InChIKey | LQNUJRBZIUSMEX-FCHUYYIVSA-N |
| XLogP | 2.83 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|