C23H28F6N2O2 — CID 71523060
N-cyclopropyl-2-fluoro-4-[2-[(1S,2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide (PubChem CID 71523060) has the molecular formula C23H28F6N2O2 and a molecular weight of 478.48 g/mol. Its IUPAC name is N-cyclopropyl-2-fluoro-4-[2-[(1S,2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide.
| Compound Name | N-cyclopropyl-2-fluoro-4-[2-[(1S,2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide |
|---|---|
| PubChem CID | 71523060 |
| Molecular Formula | C23H28F6N2O2 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-cyclopropyl-2-fluoro-4-[2-[(1S,2R)-2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(OCC[C@@H]2C[C@@H]2C2CCN(CC(F)(F)C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C23H28F6N2O2/c24-20-12-17(3-4-18(20)21(32)30-16-1-2-16)33-10-7-15-11-19(15)14-5-8-31(9-6-14)13-22(25,26)23(27,28)29/h3-4,12,14-16,19H,1-2,5-11,13H2,(H,30,32)/t15-,19-/m1/s1 |
| InChIKey | VDMSFAIDOZTDBI-DNVCBOLYSA-N |
| XLogP | 5.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|