C23H27F7N2O2 — CID 78097319
N-cyclopropyl-2,6-difluoro-4-[2-[2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide (PubChem CID 78097319) has the molecular formula C23H27F7N2O2 and a molecular weight of 496.47 g/mol. Its IUPAC name is N-cyclopropyl-2,6-difluoro-4-[2-[2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide.
| Compound Name | N-cyclopropyl-2,6-difluoro-4-[2-[2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide |
|---|---|
| PubChem CID | 78097319 |
| Molecular Formula | C23H27F7N2O2 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-cyclopropyl-2,6-difluoro-4-[2-[2-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]cyclopropyl]ethoxy]benzamide |
| SMILES | O=C(NC1CC1)c1c(F)cc(OCCC2CC2C2CCN(CC(F)(F)C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C23H27F7N2O2/c24-18-10-16(11-19(25)20(18)21(33)31-15-1-2-15)34-8-5-14-9-17(14)13-3-6-32(7-4-13)12-22(26,27)23(28,29)30/h10-11,13-15,17H,1-9,12H2,(H,31,33) |
| InChIKey | FMEUPIKEJSDTOC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|