C33H67NO6Si2 — CID 71531035
tert-butyl (2S,3S,3aS,4S,6S,7aS)-3,3a-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-2-(hydroxymethyl)-6-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 71531035) has the molecular formula C33H67NO6Si2 and a molecular weight of 630.07 g/mol. Its IUPAC name is tert-butyl (2S,3S,3aS,4S,6S,7aS)-3,3a-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-2-(hydroxymethyl)-6-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,3aS,4S,6S,7aS)-3,3a-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-2-(hydroxymethyl)-6-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 71531035 |
| Molecular Formula | C33H67NO6Si2 |
| Molecular Weight | 630.07 g/mol |
| Exact Mass | 629.45 |
| IUPAC Name | tert-butyl (2S,3S,3aS,4S,6S,7aS)-3,3a-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-2-(hydroxymethyl)-6-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| SMILES | C[C@H]1C[C@@H]2N(C(=O)OC(C)(C)C)[C@H](CO)[C@@H](CCCO[Si](C)(C)C(C)(C)C)[C@]2(CCCO[Si](C)(C)C(C)(C)C)[C@@H](O)C1 |
| InChI | InChI=1S/C33H67NO6Si2/c1-24-21-27-33(28(36)22-24,18-16-20-39-42(13,14)32(8,9)10)25(17-15-19-38-41(11,12)31(5,6)7)26(23-35)34(27)29(37)40-30(2,3)4/h24-28,35-36H,15-23H2,1-14H3/t24-,25+,26+,27-,28-,33-/m0/s1 |
| InChIKey | JAACFVOVQXVATK-YNQBZKFQSA-N |
| XLogP | 7.96 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.07 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|