C25H24N2O6 — CID 71536067
4-[hydroxy-[6-oxo-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-5-yl]methyl]benzonitrile (PubChem CID 71536067) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 4-[hydroxy-[6-oxo-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-5-yl]methyl]benzonitrile.
| Compound Name | 4-[hydroxy-[6-oxo-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-5-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 71536067 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-[hydroxy-[6-oxo-1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-5-yl]methyl]benzonitrile |
| SMILES | COc1cc(/C=C/C(=O)N2CCC=C(C(O)c3ccc(C#N)cc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N2O6/c1-31-20-13-17(14-21(32-2)24(20)33-3)8-11-22(28)27-12-4-5-19(25(27)30)23(29)18-9-6-16(15-26)7-10-18/h5-11,13-14,23,29H,4,12H2,1-3H3/b11-8+ |
| InChIKey | NSIQNCVFPRQATA-DHZHZOJOSA-N |
| XLogP | 3.02 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|