C28H31N3O4 — CID 71547096
tert-butyl 3-[(E)-3-oxo-3-[3-(piperidine-1-carbonyl)anilino]prop-1-enyl]indole-1-carboxylate (PubChem CID 71547096) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is tert-butyl 3-[(E)-3-oxo-3-[3-(piperidine-1-carbonyl)anilino]prop-1-enyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-3-oxo-3-[3-(piperidine-1-carbonyl)anilino]prop-1-enyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 71547096 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | tert-butyl 3-[(E)-3-oxo-3-[3-(piperidine-1-carbonyl)anilino]prop-1-enyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(/C=C/C(=O)Nc2cccc(C(=O)N3CCCCC3)c2)c2ccccc21 |
| InChI | InChI=1S/C28H31N3O4/c1-28(2,3)35-27(34)31-19-21(23-12-5-6-13-24(23)31)14-15-25(32)29-22-11-9-10-20(18-22)26(33)30-16-7-4-8-17-30/h5-6,9-15,18-19H,4,7-8,16-17H2,1-3H3,(H,29,32)/b15-14+ |
| InChIKey | FBWIDYADBFDPMX-CCEZHUSRSA-N |
| XLogP | 5.70 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|