C26H28BrN3O4 — CID 71468332
tert-butyl 3-[(E)-3-[[(3-bromobenzoyl)amino]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate (PubChem CID 71468332) has the molecular formula C26H28BrN3O4 and a molecular weight of 526.43 g/mol. Its IUPAC name is tert-butyl 3-[(E)-3-[[(3-bromobenzoyl)amino]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-3-[[(3-bromobenzoyl)amino]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 71468332 |
| Molecular Formula | C26H28BrN3O4 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | tert-butyl 3-[(E)-3-[[(3-bromobenzoyl)amino]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate |
| SMILES | CC(C)N(NC(=O)c1cccc(Br)c1)C(=O)/C=C/c1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C26H28BrN3O4/c1-17(2)30(28-24(32)18-9-8-10-20(27)15-18)23(31)14-13-19-16-29(25(33)34-26(3,4)5)22-12-7-6-11-21(19)22/h6-17H,1-5H3,(H,28,32)/b14-13+ |
| InChIKey | RTGPDWFMPJQWLK-BUHFOSPRSA-N |
| XLogP | 5.78 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|