C27H29ClN2O4 — CID 160937481
tert-butyl 3-[(E)-3-[[2-(3-chlorophenyl)-2-oxoethyl]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate (PubChem CID 160937481) has the molecular formula C27H29ClN2O4 and a molecular weight of 480.99 g/mol. Its IUPAC name is tert-butyl 3-[(E)-3-[[2-(3-chlorophenyl)-2-oxoethyl]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-3-[[2-(3-chlorophenyl)-2-oxoethyl]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 160937481 |
| Molecular Formula | C27H29ClN2O4 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | tert-butyl 3-[(E)-3-[[2-(3-chlorophenyl)-2-oxoethyl]-propan-2-ylamino]-3-oxoprop-1-enyl]indole-1-carboxylate |
| SMILES | CC(C)N(CC(=O)c1cccc(Cl)c1)C(=O)/C=C/c1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C27H29ClN2O4/c1-18(2)29(17-24(31)19-9-8-10-21(28)15-19)25(32)14-13-20-16-30(26(33)34-27(3,4)5)23-12-7-6-11-22(20)23/h6-16,18H,17H2,1-5H3/b14-13+ |
| InChIKey | SUBHIUUMLOQVRF-BUHFOSPRSA-N |
| XLogP | 6.21 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|