C28H34N2O6 — CID 71549842
(5R)-5-benzyl-3-[(1R)-1-cyclohexylethyl]-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide (PubChem CID 71549842) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[(1R)-1-cyclohexylethyl]-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-5-benzyl-3-[(1R)-1-cyclohexylethyl]-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71549842 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (5R)-5-benzyl-3-[(1R)-1-cyclohexylethyl]-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide |
| SMILES | COc1cc(CNC(=O)[C@@]2(Cc3ccccc3)OC(=O)N([C@H](C)C3CCCCC3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C28H34N2O6/c1-19(22-12-8-5-9-13-22)30-26(32)28(36-27(30)33,17-20-10-6-4-7-11-20)25(31)29-18-21-14-23(34-2)16-24(15-21)35-3/h4,6-7,10-11,14-16,19,22H,5,8-9,12-13,17-18H2,1-3H3,(H,29,31)/t19-,28-/m1/s1 |
| InChIKey | UQMXAKQCHCETLA-WHLCRQNOSA-N |
| XLogP | 4.25 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|