C28H28N2O6 — CID 71726558
(5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1S)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide (PubChem CID 71726558) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1S)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1S)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71726558 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-[(1S)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide |
| SMILES | COc1cc(CNC(=O)[C@@]2(Cc3ccccc3)OC(=O)N([C@@H](C)c3ccccc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C28H28N2O6/c1-19(22-12-8-5-9-13-22)30-26(32)28(36-27(30)33,17-20-10-6-4-7-11-20)25(31)29-18-21-14-23(34-2)16-24(15-21)35-3/h4-16,19H,17-18H2,1-3H3,(H,29,31)/t19-,28+/m0/s1 |
| InChIKey | UOOMYPHRFLZIRW-HMILPKGGSA-N |
| XLogP | 4.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|