C16H18BN5O3S — CID 71550249
[(1R)-2-[4-(3-aminophenyl)triazol-1-yl]-1-[(2-thiophen-2-ylacetyl)amino]ethyl]boronic acid (PubChem CID 71550249) has the molecular formula C16H18BN5O3S and a molecular weight of 371.23 g/mol. Its IUPAC name is [(1R)-2-[4-(3-aminophenyl)triazol-1-yl]-1-[(2-thiophen-2-ylacetyl)amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-[4-(3-aminophenyl)triazol-1-yl]-1-[(2-thiophen-2-ylacetyl)amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 71550249 |
| Molecular Formula | C16H18BN5O3S |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(1R)-2-[4-(3-aminophenyl)triazol-1-yl]-1-[(2-thiophen-2-ylacetyl)amino]ethyl]boronic acid |
| SMILES | Nc1cccc(-c2cn(C[C@H](NC(=O)Cc3cccs3)B(O)O)nn2)c1 |
| InChI | InChI=1S/C16H18BN5O3S/c18-12-4-1-3-11(7-12)14-9-22(21-20-14)10-15(17(24)25)19-16(23)8-13-5-2-6-26-13/h1-7,9,15,24-25H,8,10,18H2,(H,19,23)/t15-/m0/s1 |
| InChIKey | XHDDNBKGPAEKIK-HNNXBMFYSA-N |
| XLogP | 0.33 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|