C17H31N5O2S — CID 71551707
(2S)-6-amino-2-[(2-aminoacetyl)amino]-N-[2-[5-(3-aminopropyl)thiophen-2-yl]ethyl]hexanamide (PubChem CID 71551707) has the molecular formula C17H31N5O2S and a molecular weight of 369.54 g/mol. Its IUPAC name is (2S)-6-amino-2-[(2-aminoacetyl)amino]-N-[2-[5-(3-aminopropyl)thiophen-2-yl]ethyl]hexanamide.
| Compound Name | (2S)-6-amino-2-[(2-aminoacetyl)amino]-N-[2-[5-(3-aminopropyl)thiophen-2-yl]ethyl]hexanamide |
|---|---|
| PubChem CID | 71551707 |
| Molecular Formula | C17H31N5O2S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (2S)-6-amino-2-[(2-aminoacetyl)amino]-N-[2-[5-(3-aminopropyl)thiophen-2-yl]ethyl]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)CN)C(=O)NCCc1ccc(CCCN)s1 |
| InChI | InChI=1S/C17H31N5O2S/c18-9-2-1-5-15(22-16(23)12-20)17(24)21-11-8-14-7-6-13(25-14)4-3-10-19/h6-7,15H,1-5,8-12,18-20H2,(H,21,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | QAHDMGYVTFBJIB-HNNXBMFYSA-N |
| XLogP | -0.13 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|