C17H19N2O+ — CID 71557197
1-prop-2-enyl-3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)imidazol-1-ium (PubChem CID 71557197) has the molecular formula C17H19N2O+ and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)imidazol-1-ium.
| Compound Name | 1-prop-2-enyl-3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 71557197 |
| Molecular Formula | C17H19N2O+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-prop-2-enyl-3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)imidazol-1-ium |
| SMILES | C=CC[n+]1ccn(C2CCc3cc4c(cc32)OCC4)c1 |
| InChI | InChI=1S/C17H19N2O/c1-2-6-18-7-8-19(12-18)16-4-3-13-10-14-5-9-20-17(14)11-15(13)16/h2,7-8,10-12,16H,1,3-6,9H2/q+1 |
| InChIKey | JCEINHFUWAVWKQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|