C26H23BrN2O2 — CID 71557845
1-phenyl-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone bromide (PubChem CID 71557845) has the molecular formula C26H23BrN2O2 and a molecular weight of 475.39 g/mol. Its IUPAC name is 1-phenyl-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-phenyl-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 71557845 |
| Molecular Formula | C26H23BrN2O2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 1-phenyl-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone bromide |
| SMILES | O=C(C[n+]1cn(C2CCc3cc4c(cc32)OCC4)c2ccccc21)c1ccccc1.[Br-] |
| InChI | InChI=1S/C26H23N2O2.BrH/c29-25(18-6-2-1-3-7-18)16-27-17-28(24-9-5-4-8-23(24)27)22-11-10-19-14-20-12-13-30-26(20)15-21(19)22;/h1-9,14-15,17,22H,10-13,16H2;1H/q+1;/p-1 |
| InChIKey | OKUYGOTVTRZPIJ-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|