C23H18ClFN2O2S2 — CID 71567789
2-chloro-N-[5-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide (PubChem CID 71567789) has the molecular formula C23H18ClFN2O2S2 and a molecular weight of 472.99 g/mol. Its IUPAC name is 2-chloro-N-[5-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[5-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71567789 |
| Molecular Formula | C23H18ClFN2O2S2 |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 2-chloro-N-[5-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide |
| SMILES | COc1ccc(CSc2ccc(-c3nc4ccc(F)cc4s3)cc2NC(=O)CCl)cc1 |
| InChI | InChI=1S/C23H18ClFN2O2S2/c1-29-17-6-2-14(3-7-17)13-30-20-9-4-15(10-19(20)26-22(28)12-24)23-27-18-8-5-16(25)11-21(18)31-23/h2-11H,12-13H2,1H3,(H,26,28) |
| InChIKey | WKOHCKIKSPSLAN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|