C23H21N3O3S2 — CID 71568163
4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]-2-nitroaniline (PubChem CID 71568163) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]-2-nitroaniline.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 71568163 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[2-[(4-methoxyphenyl)methylsulfanyl]ethyl]-2-nitroaniline |
| SMILES | COc1ccc(CSCCNc2ccc(-c3nc4ccccc4s3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21N3O3S2/c1-29-18-9-6-16(7-10-18)15-30-13-12-24-19-11-8-17(14-21(19)26(27)28)23-25-20-4-2-3-5-22(20)31-23/h2-11,14,24H,12-13,15H2,1H3 |
| InChIKey | IMDAMIUPUMLYIQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|