C30H34Cl2FN3O3 — CID 71568524
(3S,3'R,5'R)-6-chloro-5'-(3-chloro-2-fluorophenyl)-3'-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-cyclopentene]-1'-carboxamide (PubChem CID 71568524) has the molecular formula C30H34Cl2FN3O3 and a molecular weight of 574.52 g/mol. Its IUPAC name is (3S,3'R,5'R)-6-chloro-5'-(3-chloro-2-fluorophenyl)-3'-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-cyclopentene]-1'-carboxamide.
| Compound Name | (3S,3'R,5'R)-6-chloro-5'-(3-chloro-2-fluorophenyl)-3'-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-cyclopentene]-1'-carboxamide |
|---|---|
| PubChem CID | 71568524 |
| Molecular Formula | C30H34Cl2FN3O3 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | (3S,3'R,5'R)-6-chloro-5'-(3-chloro-2-fluorophenyl)-3'-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-cyclopentene]-1'-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1C=C(C(=O)NCCN2CCOCC2)[C@@H](c2cccc(Cl)c2F)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C30H34Cl2FN3O3/c1-29(2,3)17-18-15-21(27(37)34-9-10-36-11-13-39-14-12-36)25(20-5-4-6-23(32)26(20)33)30(18)22-8-7-19(31)16-24(22)35-28(30)38/h4-8,15-16,18,25H,9-14,17H2,1-3H3,(H,34,37)(H,35,38)/t18-,25+,30+/m0/s1 |
| InChIKey | KVVPUBZAAUAFGG-DHDSDNCCSA-N |
| XLogP | 5.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |