C20H19FN4O3 — CID 71569830
4-[[3-(3-fluorophenyl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine (PubChem CID 71569830) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is 4-[[3-(3-fluorophenyl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine.
| Compound Name | 4-[[3-(3-fluorophenyl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine |
|---|---|
| PubChem CID | 71569830 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[[3-(3-fluorophenyl)phenyl]methyl]-9-nitro-2,3,5,6-tetrahydroimidazo[2,1-b][1,3,6]oxadiazocine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OCCN(Cc1cccc(-c3cccc(F)c3)c1)CC2 |
| InChI | InChI=1S/C20H19FN4O3/c21-18-6-2-5-17(12-18)16-4-1-3-15(11-16)13-23-7-8-24-14-19(25(26)27)22-20(24)28-10-9-23/h1-6,11-12,14H,7-10,13H2 |
| InChIKey | RDKWCTGNTWVERJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|