C17H32O3Si — CID 71573792
methyl (1S,2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 71573792) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is methyl (1S,2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 71573792 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | methyl (1S,2R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]1C(=O)OC |
| InChI | InChI=1S/C17H32O3Si/c1-11(2)13-10-14(12(3)15(13)16(18)19-7)20-21(8,9)17(4,5)6/h12-15H,1,10H2,2-9H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | XLRLCHHCYHEYBE-LJISPDSOSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|