C23H16FN7O2 — CID 71578441
1-(3-fluorophenyl)-2-oxo-N-[4-(7H-purin-6-ylamino)phenyl]pyridine-3-carboxamide (PubChem CID 71578441) has the molecular formula C23H16FN7O2 and a molecular weight of 441.43 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-oxo-N-[4-(7H-purin-6-ylamino)phenyl]pyridine-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-2-oxo-N-[4-(7H-purin-6-ylamino)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71578441 |
| Molecular Formula | C23H16FN7O2 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-(3-fluorophenyl)-2-oxo-N-[4-(7H-purin-6-ylamino)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ncnc3nc[nH]c23)cc1)c1cccn(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C23H16FN7O2/c24-14-3-1-4-17(11-14)31-10-2-5-18(23(31)33)22(32)30-16-8-6-15(7-9-16)29-21-19-20(26-12-25-19)27-13-28-21/h1-13H,(H,30,32)(H2,25,26,27,28,29) |
| InChIKey | HFONFGGWUOXEJB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |