C30H38ClN5O4S — CID 71594347
6-chloro-N-[(3R)-3-[4-[[4-(dihydroxymethyl)phenyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 71594347) has the molecular formula C30H38ClN5O4S and a molecular weight of 600.19 g/mol. Its IUPAC name is 6-chloro-N-[(3R)-3-[4-[[4-(dihydroxymethyl)phenyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(3R)-3-[4-[[4-(dihydroxymethyl)phenyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71594347 |
| Molecular Formula | C30H38ClN5O4S |
| Molecular Weight | 600.19 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 6-chloro-N-[(3R)-3-[4-[[4-(dihydroxymethyl)phenyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCC[C@@H](C)N1CCC(N(Cc2ccsc2)C(=O)Nc2ccc(C(O)O)cc2)CC1 |
| InChI | InChI=1S/C30H38ClN5O4S/c1-19-16-26(31)33-21(3)27(19)28(37)32-12-8-20(2)35-13-9-25(10-14-35)36(17-22-11-15-41-18-22)30(40)34-24-6-4-23(5-7-24)29(38)39/h4-7,11,15-16,18,20,25,29,38-39H,8-10,12-14,17H2,1-3H3,(H,32,37)(H,34,40)/t20-/m1/s1 |
| InChIKey | BLWVWNLFIQIMGM-HXUWFJFHSA-N |
| XLogP | 5.10 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.19 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|