C20H19N3O — CID 71604672
(1S,12S,15S)-1-methyl-14-oxa-3,20,23-triazahexacyclo[10.10.1.02,10.04,9.015,23.017,22]tricosa-2(10),4,6,8,17(22),18,20-heptaene (PubChem CID 71604672) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (1S,12S,15S)-1-methyl-14-oxa-3,20,23-triazahexacyclo[10.10.1.02,10.04,9.015,23.017,22]tricosa-2(10),4,6,8,17(22),18,20-heptaene.
| Compound Name | (1S,12S,15S)-1-methyl-14-oxa-3,20,23-triazahexacyclo[10.10.1.02,10.04,9.015,23.017,22]tricosa-2(10),4,6,8,17(22),18,20-heptaene |
|---|---|
| PubChem CID | 71604672 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (1S,12S,15S)-1-methyl-14-oxa-3,20,23-triazahexacyclo[10.10.1.02,10.04,9.015,23.017,22]tricosa-2(10),4,6,8,17(22),18,20-heptaene |
| SMILES | C[C@]12c3cnccc3C[C@@H]3OC[C@H](Cc4c1[nH]c1ccccc41)N32 |
| InChI | InChI=1S/C20H19N3O/c1-20-16-10-21-7-6-12(16)8-18-23(20)13(11-24-18)9-15-14-4-2-3-5-17(14)22-19(15)20/h2-7,10,13,18,22H,8-9,11H2,1H3/t13-,18-,20-/m0/s1 |
| InChIKey | QIYGACZNGXPQIA-GMVOTWDCSA-N |
| XLogP | 2.97 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |