C22H18O2Se — CID 71605437
1,3-dimethoxy-5-[2-(2-phenylselanylethynyl)phenyl]benzene (PubChem CID 71605437) has the molecular formula C22H18O2Se and a molecular weight of 393.34 g/mol. Its IUPAC name is 1,3-dimethoxy-5-[2-(2-phenylselanylethynyl)phenyl]benzene.
| Compound Name | 1,3-dimethoxy-5-[2-(2-phenylselanylethynyl)phenyl]benzene |
|---|---|
| PubChem CID | 71605437 |
| Molecular Formula | C22H18O2Se |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1,3-dimethoxy-5-[2-(2-phenylselanylethynyl)phenyl]benzene |
| SMILES | COc1cc(OC)cc(-c2ccccc2C#C[Se]c2ccccc2)c1 |
| InChI | InChI=1S/C22H18O2Se/c1-23-19-14-18(15-20(16-19)24-2)22-11-7-6-8-17(22)12-13-25-21-9-4-3-5-10-21/h3-11,14-16H,1-2H3 |
| InChIKey | FXAFATJCEQOZLL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|