C26H24N2O5S — CID 71613632
(2S,3R)-2-benzyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-nitrobutanal (PubChem CID 71613632) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-nitrobutanal.
| Compound Name | (2S,3R)-2-benzyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-nitrobutanal |
|---|---|
| PubChem CID | 71613632 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (2S,3R)-2-benzyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-4-nitrobutanal |
| SMILES | Cc1ccc(S(=O)(=O)n2cc([C@H](C[N+](=O)[O-])[C@@H](C=O)Cc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H24N2O5S/c1-19-11-13-22(14-12-19)34(32,33)27-16-25(23-9-5-6-10-26(23)27)24(17-28(30)31)21(18-29)15-20-7-3-2-4-8-20/h2-14,16,18,21,24H,15,17H2,1H3/t21-,24-/m1/s1 |
| InChIKey | ADZNRDBGMZBPNJ-ZJSXRUAMSA-N |
| XLogP | 4.60 |
| TPSA | 99.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|