C31H28N2O4S — CID 102474721
3-[(1R,2S)-1,2-diphenylpentyl]-1-(4-nitrophenyl)sulfonylindole (PubChem CID 102474721) has the molecular formula C31H28N2O4S and a molecular weight of 524.64 g/mol. Its IUPAC name is 3-[(1R,2S)-1,2-diphenylpentyl]-1-(4-nitrophenyl)sulfonylindole.
| Compound Name | 3-[(1R,2S)-1,2-diphenylpentyl]-1-(4-nitrophenyl)sulfonylindole |
|---|---|
| PubChem CID | 102474721 |
| Molecular Formula | C31H28N2O4S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 3-[(1R,2S)-1,2-diphenylpentyl]-1-(4-nitrophenyl)sulfonylindole |
| SMILES | CCC[C@H](c1ccccc1)[C@H](c1ccccc1)c1cn(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc12 |
| InChI | InChI=1S/C31H28N2O4S/c1-2-11-27(23-12-5-3-6-13-23)31(24-14-7-4-8-15-24)29-22-32(30-17-10-9-16-28(29)30)38(36,37)26-20-18-25(19-21-26)33(34)35/h3-10,12-22,27,31H,2,11H2,1H3/t27-,31+/m1/s1 |
| InChIKey | IGXNVOVZBRIQDF-JOMNFKBKSA-N |
| XLogP | 7.50 |
| TPSA | 82.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|