C22H26O — CID 71614474
(2S,4aR,10bS)-2-(4-propan-2-ylphenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene (PubChem CID 71614474) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is (2S,4aR,10bS)-2-(4-propan-2-ylphenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene.
| Compound Name | (2S,4aR,10bS)-2-(4-propan-2-ylphenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene |
|---|---|
| PubChem CID | 71614474 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (2S,4aR,10bS)-2-(4-propan-2-ylphenyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene |
| SMILES | CC(C)c1ccc([C@@H]2C[C@@H]3c4ccccc4CC[C@H]3CO2)cc1 |
| InChI | InChI=1S/C22H26O/c1-15(2)16-7-10-18(11-8-16)22-13-21-19(14-23-22)12-9-17-5-3-4-6-20(17)21/h3-8,10-11,15,19,21-22H,9,12-14H2,1-2H3/t19-,21-,22-/m0/s1 |
| InChIKey | GUHOIWCJSXNUJM-BVSLBCMMSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |