C13H16O2 — CID 11321664
2-(2,3-dihydro-1H-inden-1-yl)-4-methyl-1,3-dioxolane (PubChem CID 11321664) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-yl)-4-methyl-1,3-dioxolane.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-yl)-4-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11321664 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-yl)-4-methyl-1,3-dioxolane |
| SMILES | CC1COC(C2CCc3ccccc32)O1 |
| InChI | InChI=1S/C13H16O2/c1-9-8-14-13(15-9)12-7-6-10-4-2-3-5-11(10)12/h2-5,9,12-13H,6-8H2,1H3 |
| InChIKey | OMOHCDREDNQSKL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |