C25H21NO3 — CID 71615045
(4R)-4-methyl-4-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 71615045) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is (4R)-4-methyl-4-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-methyl-4-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 71615045 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (4R)-4-methyl-4-[(1R)-3-oxo-1,3-diphenylpropyl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | C[C@]1([C@H](CC(=O)c2ccccc2)c2ccccc2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C25H21NO3/c1-25(24(28)29-23(26-25)20-15-9-4-10-16-20)21(18-11-5-2-6-12-18)17-22(27)19-13-7-3-8-14-19/h2-16,21H,17H2,1H3/t21-,25-/m1/s1 |
| InChIKey | YXACKAGUIXSYIA-PXDATVDWSA-N |
| XLogP | 4.81 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |