C24H36N2O5 — CID 71616934
N-hydroxy-2-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-1,3-oxazol-2-yl]pentan-3-yl]-2-methylphenoxy]acetamide (PubChem CID 71616934) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is N-hydroxy-2-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-1,3-oxazol-2-yl]pentan-3-yl]-2-methylphenoxy]acetamide.
| Compound Name | N-hydroxy-2-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-1,3-oxazol-2-yl]pentan-3-yl]-2-methylphenoxy]acetamide |
|---|---|
| PubChem CID | 71616934 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | N-hydroxy-2-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-1,3-oxazol-2-yl]pentan-3-yl]-2-methylphenoxy]acetamide |
| SMILES | CCC(CC)(c1ccc(OCC(=O)NO)c(C)c1)c1nc(CCC(O)C(C)(C)C)co1 |
| InChI | InChI=1S/C24H36N2O5/c1-7-24(8-2,17-9-11-19(16(3)13-17)30-15-21(28)26-29)22-25-18(14-31-22)10-12-20(27)23(4,5)6/h9,11,13-14,20,27,29H,7-8,10,12,15H2,1-6H3,(H,26,28) |
| InChIKey | XTAXYDQZLNJUOQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|