C28H31N3O6 — CID 71619573
dimethyl (3aR,9R,9aS)-1,5'-bis(tert-butylimino)-9a-cyanospiro[3aH-cyclopenta[b]chromene-9,2'-furan]-3,3'-dicarboxylate (PubChem CID 71619573) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is dimethyl (3aR,9R,9aS)-1,5'-bis(tert-butylimino)-9a-cyanospiro[3aH-cyclopenta[b]chromene-9,2'-furan]-3,3'-dicarboxylate.
| Compound Name | dimethyl (3aR,9R,9aS)-1,5'-bis(tert-butylimino)-9a-cyanospiro[3aH-cyclopenta[b]chromene-9,2'-furan]-3,3'-dicarboxylate |
|---|---|
| PubChem CID | 71619573 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | dimethyl (3aR,9R,9aS)-1,5'-bis(tert-butylimino)-9a-cyanospiro[3aH-cyclopenta[b]chromene-9,2'-furan]-3,3'-dicarboxylate |
| SMILES | COC(=O)C1=C/C(=N\C(C)(C)C)[C@]2(C#N)[C@H]1Oc1ccccc1[C@]21O/C(=N/C(C)(C)C)C=C1C(=O)OC |
| InChI | InChI=1S/C28H31N3O6/c1-25(2,3)30-20-13-16(23(32)34-7)22-27(20,15-29)28(17-11-9-10-12-19(17)36-22)18(24(33)35-8)14-21(37-28)31-26(4,5)6/h9-14,22H,1-8H3/b30-20+,31-21+/t22-,27+,28+/m0/s1 |
| InChIKey | ZBRMNBTWXLNNLW-ZUCLTTMXSA-N |
| XLogP | 3.83 |
| TPSA | 119.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|