C16H24O2 — CID 71620171
2-(4-pent-4-ynylcyclohex-2-en-1-yl)oxyoxane (PubChem CID 71620171) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-(4-pent-4-ynylcyclohex-2-en-1-yl)oxyoxane.
| Compound Name | 2-(4-pent-4-ynylcyclohex-2-en-1-yl)oxyoxane |
|---|---|
| PubChem CID | 71620171 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2-(4-pent-4-ynylcyclohex-2-en-1-yl)oxyoxane |
| SMILES | C#CCCCC1C=CC(OC2CCCCO2)CC1 |
| InChI | InChI=1S/C16H24O2/c1-2-3-4-7-14-9-11-15(12-10-14)18-16-8-5-6-13-17-16/h1,9,11,14-16H,3-8,10,12-13H2 |
| InChIKey | OXSLUVAHHUNBFE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|