C11H18O3 — CID 102478791
(4aR,7S,8aS)-2,7-dimethoxy-3,4,4a,7,8,8a-hexahydro-2H-chromene (PubChem CID 102478791) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (4aR,7S,8aS)-2,7-dimethoxy-3,4,4a,7,8,8a-hexahydro-2H-chromene.
| Compound Name | (4aR,7S,8aS)-2,7-dimethoxy-3,4,4a,7,8,8a-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 102478791 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (4aR,7S,8aS)-2,7-dimethoxy-3,4,4a,7,8,8a-hexahydro-2H-chromene |
| SMILES | COC1CC[C@@H]2C=C[C@@H](OC)C[C@@H]2O1 |
| InChI | InChI=1S/C11H18O3/c1-12-9-5-3-8-4-6-11(13-2)14-10(8)7-9/h3,5,8-11H,4,6-7H2,1-2H3/t8-,9+,10-,11?/m0/s1 |
| InChIKey | PAZOSWCDTQUYFD-JDUUOCRZSA-N |
| XLogP | 1.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|