C7H9N4O3+ — CID 71650720
1,3-dimethylpurin-3-ium-2,6-dione;hydrate (PubChem CID 71650720) has the molecular formula C7H9N4O3+ and a molecular weight of 197.17 g/mol. Its IUPAC name is 1,3-dimethylpurin-3-ium-2,6-dione;hydrate.
| Compound Name | 1,3-dimethylpurin-3-ium-2,6-dione;hydrate |
|---|---|
| PubChem CID | 71650720 |
| Molecular Formula | C7H9N4O3+ |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1,3-dimethylpurin-3-ium-2,6-dione;hydrate |
| SMILES | CN1C(=O)C2=NC=NC2=[N+](C)C1=O.O |
| InChI | InChI=1S/C7H7N4O2.H2O/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;/h3H,1-2H3;1H2/q+1; |
| InChIKey | HGMVHMRIZZKDFW-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|