C13H12ClFN2O3 — CID 71653398
(3-chloro-6-fluoro-4-oxidoquinoxalin-4-ium-2-yl) 2,2-dimethylpropanoate (PubChem CID 71653398) has the molecular formula C13H12ClFN2O3 and a molecular weight of 298.70 g/mol. Its IUPAC name is (3-chloro-6-fluoro-4-oxidoquinoxalin-4-ium-2-yl) 2,2-dimethylpropanoate.
| Compound Name | (3-chloro-6-fluoro-4-oxidoquinoxalin-4-ium-2-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71653398 |
| Molecular Formula | C13H12ClFN2O3 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (3-chloro-6-fluoro-4-oxidoquinoxalin-4-ium-2-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1nc2ccc(F)cc2[n+]([O-])c1Cl |
| InChI | InChI=1S/C13H12ClFN2O3/c1-13(2,3)12(18)20-11-10(14)17(19)9-6-7(15)4-5-8(9)16-11/h4-6H,1-3H3 |
| InChIKey | ASQJLCGALYYLBA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|