C15H19ClF2O3 — CID 139531450
[(2R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxybutan-2-yl] 2,2-dimethylpropanoate (PubChem CID 139531450) has the molecular formula C15H19ClF2O3 and a molecular weight of 320.76 g/mol. Its IUPAC name is [(2R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxybutan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxybutan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139531450 |
| Molecular Formula | C15H19ClF2O3 |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [(2R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxybutan-2-yl] 2,2-dimethylpropanoate |
| SMILES | C[C@@H](OC(=O)C(C)(C)C)C(O)(CCl)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H19ClF2O3/c1-9(21-13(19)14(2,3)4)15(20,8-16)11-6-5-10(17)7-12(11)18/h5-7,9,20H,8H2,1-4H3/t9-,15?/m1/s1 |
| InChIKey | PVTNHTLQDDZLFA-WXMRUQJCSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|