C17H22F2O5 — CID 90805539
[1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate (PubChem CID 90805539) has the molecular formula C17H22F2O5 and a molecular weight of 344.35 g/mol. Its IUPAC name is [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate.
| Compound Name | [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 90805539 |
| Molecular Formula | C17H22F2O5 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OC(OC(=O)CCC)C(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H22F2O5/c1-4-6-14(20)23-16(24-15(21)7-5-2)17(3,22)12-9-8-11(18)10-13(12)19/h8-10,16,22H,4-7H2,1-3H3 |
| InChIKey | XWGGWASSKOPODO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|