About [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate
[1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate (PubChem CID 90805539) has the molecular formula C17H22F2O5
and a molecular weight of 344.35 g/mol. Its IUPAC name is [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate.
Molecular Properties
| Compound Name | [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate |
| PubChem CID | 90805539 |
| Molecular Formula | C17H22F2O5 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OC(OC(=O)CCC)C(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H22F2O5/c1-4-6-14(20)23-16(24-15(21)7-5-2)17(3,22)12-9-8-11(18)10-13(12)19/h8-10,16,22H,4-7H2,1-3H3 |
| InChIKey | XWGGWASSKOPODO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate?
The IUPAC name of [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate (CID 90805539) is [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate.
What is the SMILES notation for [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate?
The canonical SMILES for [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate is CCCC(=O)OC(OC(=O)CCC)C(C)(O)c1ccc(F)cc1F.
What is the InChIKey of [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate?
The InChIKey is XWGGWASSKOPODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2O5/c1-4-6-14(20)23-16(24-15(21)7-5-2)17(3,22)12-9-8-11(18)10-13(12)19/h8-10,16,22H,4-7H2,1-3H3.
What are the key properties of [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate?
[1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate has a molecular weight of 344.35 g/mol, XLogP of 3.18, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-butanoyloxy-2-(2,4-difluorophenyl)-2-hydroxypropyl] butanoate is sourced from PubChem (CID 90805539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).