C18H19N3O3S — CID 71655729
1-(3-hydroxypropyl)-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea (PubChem CID 71655729) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(3-hydroxypropyl)-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 71655729 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-[6-(2-methoxyphenyl)-1,3-benzothiazol-2-yl]urea |
| SMILES | COc1ccccc1-c1ccc2nc(NC(=O)NCCCO)sc2c1 |
| InChI | InChI=1S/C18H19N3O3S/c1-24-15-6-3-2-5-13(15)12-7-8-14-16(11-12)25-18(20-14)21-17(23)19-9-4-10-22/h2-3,5-8,11,22H,4,9-10H2,1H3,(H2,19,20,21,23) |
| InChIKey | GVRAUEHOCQAFTM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|