C21H21NO4 — CID 71659068
(5Z)-5-(1-hydroxyethylidene)-1,2-bis(4-methoxyphenyl)-2H-pyridin-6-one (PubChem CID 71659068) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (5Z)-5-(1-hydroxyethylidene)-1,2-bis(4-methoxyphenyl)-2H-pyridin-6-one.
| Compound Name | (5Z)-5-(1-hydroxyethylidene)-1,2-bis(4-methoxyphenyl)-2H-pyridin-6-one |
|---|---|
| PubChem CID | 71659068 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (5Z)-5-(1-hydroxyethylidene)-1,2-bis(4-methoxyphenyl)-2H-pyridin-6-one |
| SMILES | COc1ccc(C2C=C/C(=C(\C)O)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H21NO4/c1-14(23)19-12-13-20(15-4-8-17(25-2)9-5-15)22(21(19)24)16-6-10-18(26-3)11-7-16/h4-13,20,23H,1-3H3/b19-14- |
| InChIKey | NQJNYNZWFXSDKY-RGEXLXHISA-N |
| XLogP | 4.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|