C19H17NO2 — CID 71659073
(5Z)-5-(1-hydroxyethylidene)-1,2-diphenyl-2H-pyridin-6-one (PubChem CID 71659073) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is (5Z)-5-(1-hydroxyethylidene)-1,2-diphenyl-2H-pyridin-6-one.
| Compound Name | (5Z)-5-(1-hydroxyethylidene)-1,2-diphenyl-2H-pyridin-6-one |
|---|---|
| PubChem CID | 71659073 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (5Z)-5-(1-hydroxyethylidene)-1,2-diphenyl-2H-pyridin-6-one |
| SMILES | C/C(O)=C1\C=CC(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17NO2/c1-14(21)17-12-13-18(15-8-4-2-5-9-15)20(19(17)22)16-10-6-3-7-11-16/h2-13,18,21H,1H3/b17-14- |
| InChIKey | NMNZBHWSXDIQQE-VKAVYKQESA-N |
| XLogP | 4.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|