C19H14OSSe2 — CID 71662006
5-(4-methoxyphenyl)-4-phenylselanylselenopheno[2,3-b]thiophene (PubChem CID 71662006) has the molecular formula C19H14OSSe2 and a molecular weight of 448.31 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-phenylselanylselenopheno[2,3-b]thiophene.
| Compound Name | 5-(4-methoxyphenyl)-4-phenylselanylselenopheno[2,3-b]thiophene |
|---|---|
| PubChem CID | 71662006 |
| Molecular Formula | C19H14OSSe2 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-phenylselanylselenopheno[2,3-b]thiophene |
| SMILES | COc1ccc(-c2[se]c3sccc3c2[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14OSSe2/c1-20-14-9-7-13(8-10-14)17-18(16-11-12-21-19(16)23-17)22-15-5-3-2-4-6-15/h2-12H,1H3 |
| InChIKey | FUPNANLBFXZKHU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|