C38H48O4S2Se — CID 71662363
(5R)-3-[(1S)-1-hydroxy-6,6-bis(phenylsulfanyl)hexyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one (PubChem CID 71662363) has the molecular formula C38H48O4S2Se and a molecular weight of 711.89 g/mol. Its IUPAC name is (5R)-3-[(1S)-1-hydroxy-6,6-bis(phenylsulfanyl)hexyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one.
| Compound Name | (5R)-3-[(1S)-1-hydroxy-6,6-bis(phenylsulfanyl)hexyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
|---|---|
| PubChem CID | 71662363 |
| Molecular Formula | C38H48O4S2Se |
| Molecular Weight | 711.89 g/mol |
| Exact Mass | 712.22 |
| IUPAC Name | (5R)-3-[(1S)-1-hydroxy-6,6-bis(phenylsulfanyl)hexyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@H]1CC([Se]c2ccccc2)([C@@H](O)CCCCC(Sc2ccccc2)Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C38H48O4S2Se/c1-27(2)32-24-23-28(3)25-33(32)41-35-26-38(37(40)42-35,45-31-19-11-6-12-20-31)34(39)21-13-14-22-36(43-29-15-7-4-8-16-29)44-30-17-9-5-10-18-30/h4-12,15-20,27-28,32-36,39H,13-14,21-26H2,1-3H3/t28-,32+,33-,34+,35-,38?/m1/s1 |
| InChIKey | UYBIQUDWOSEJBM-KPKBOXROSA-N |
| XLogP | 8.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.89 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|