C36H44O4S2Se — CID 71662524
(5R)-3-[(1R)-1-hydroxy-4,4-bis(phenylsulfanyl)butyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one (PubChem CID 71662524) has the molecular formula C36H44O4S2Se and a molecular weight of 683.84 g/mol. Its IUPAC name is (5R)-3-[(1R)-1-hydroxy-4,4-bis(phenylsulfanyl)butyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one.
| Compound Name | (5R)-3-[(1R)-1-hydroxy-4,4-bis(phenylsulfanyl)butyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
|---|---|
| PubChem CID | 71662524 |
| Molecular Formula | C36H44O4S2Se |
| Molecular Weight | 683.84 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | (5R)-3-[(1R)-1-hydroxy-4,4-bis(phenylsulfanyl)butyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-phenylselanyloxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@H]1CC([Se]c2ccccc2)([C@H](O)CCC(Sc2ccccc2)Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C36H44O4S2Se/c1-25(2)30-20-19-26(3)23-31(30)39-33-24-36(35(38)40-33,43-29-17-11-6-12-18-29)32(37)21-22-34(41-27-13-7-4-8-14-27)42-28-15-9-5-10-16-28/h4-18,25-26,30-34,37H,19-24H2,1-3H3/t26-,30+,31-,32-,33-,36?/m1/s1 |
| InChIKey | UMMHWKCWXZNURP-YSOFQDMQSA-N |
| XLogP | 7.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.84 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|