C39H48O5S2Se — CID 71663081
[(1R)-1-[(5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxo-3-phenylselanyloxolan-3-yl]-5,5-bis(phenylsulfanyl)pentyl] acetate (PubChem CID 71663081) has the molecular formula C39H48O5S2Se and a molecular weight of 739.90 g/mol. Its IUPAC name is [(1R)-1-[(5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxo-3-phenylselanyloxolan-3-yl]-5,5-bis(phenylsulfanyl)pentyl] acetate.
| Compound Name | [(1R)-1-[(5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxo-3-phenylselanyloxolan-3-yl]-5,5-bis(phenylsulfanyl)pentyl] acetate |
|---|---|
| PubChem CID | 71663081 |
| Molecular Formula | C39H48O5S2Se |
| Molecular Weight | 739.90 g/mol |
| Exact Mass | 740.21 |
| IUPAC Name | [(1R)-1-[(5R)-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxo-3-phenylselanyloxolan-3-yl]-5,5-bis(phenylsulfanyl)pentyl] acetate |
| SMILES | CC(=O)O[C@H](CCCC(Sc1ccccc1)Sc1ccccc1)C1([Se]c2ccccc2)C[C@H](O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)OC1=O |
| InChI | InChI=1S/C39H48O5S2Se/c1-27(2)33-24-23-28(3)25-34(33)43-36-26-39(38(41)44-36,47-32-19-12-7-13-20-32)35(42-29(4)40)21-14-22-37(45-30-15-8-5-9-16-30)46-31-17-10-6-11-18-31/h5-13,15-20,27-28,33-37H,14,21-26H2,1-4H3/t28-,33+,34-,35-,36-,39?/m1/s1 |
| InChIKey | YUQWCJXPEPPDBC-KVWCOAJBSA-N |
| XLogP | 8.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.90 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|