C11H24BrN2+ — CID 7166604
[(2R)-2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-methylazanium (PubChem CID 7166604) has the molecular formula C11H24BrN2+ and a molecular weight of 264.23 g/mol. Its IUPAC name is [(2R)-2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-methylazanium.
| Compound Name | [(2R)-2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-methylazanium |
|---|---|
| PubChem CID | 7166604 |
| Molecular Formula | C11H24BrN2+ |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [(2R)-2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-methylazanium |
| SMILES | C/[NH+]=C(\NC(C)(C)C)[C@H](Br)C(C)(C)C |
| InChI | InChI=1S/C11H23BrN2/c1-10(2,3)8(12)9(13-7)14-11(4,5)6/h8H,1-7H3,(H,13,14)/p+1/t8-/m0/s1 |
| InChIKey | OMQHAFZKZSVFST-QMMMGPOBSA-O |
| XLogP | 1.29 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|