C14H30BrClN2O4 — CID 132771780
[2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-tert-butylazanium perchlorate (PubChem CID 132771780) has the molecular formula C14H30BrClN2O4 and a molecular weight of 405.76 g/mol. Its IUPAC name is [2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-tert-butylazanium perchlorate.
| Compound Name | [2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-tert-butylazanium perchlorate |
|---|---|
| PubChem CID | 132771780 |
| Molecular Formula | C14H30BrClN2O4 |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [2-bromo-1-(tert-butylamino)-3,3-dimethylbutylidene]-tert-butylazanium perchlorate |
| SMILES | CC(C)(C)N/C(=[NH+]\C(C)(C)C)C(Br)C(C)(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C14H29BrN2.ClHO4/c1-12(2,3)10(15)11(16-13(4,5)6)17-14(7,8)9;2-1(3,4)5/h10H,1-9H3,(H,16,17);(H,2,3,4,5) |
| InChIKey | YLPDQIZRFUKOCK-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 118.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|