C23H21BrN2O — CID 71666506
N-(1-benzhydrylazetidin-3-yl)-2-bromobenzamide (PubChem CID 71666506) has the molecular formula C23H21BrN2O and a molecular weight of 421.34 g/mol. Its IUPAC name is N-(1-benzhydrylazetidin-3-yl)-2-bromobenzamide.
| Compound Name | N-(1-benzhydrylazetidin-3-yl)-2-bromobenzamide |
|---|---|
| PubChem CID | 71666506 |
| Molecular Formula | C23H21BrN2O |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-(1-benzhydrylazetidin-3-yl)-2-bromobenzamide |
| SMILES | O=C(NC1CN(C(c2ccccc2)c2ccccc2)C1)c1ccccc1Br |
| InChI | InChI=1S/C23H21BrN2O/c24-21-14-8-7-13-20(21)23(27)25-19-15-26(16-19)22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,19,22H,15-16H2,(H,25,27) |
| InChIKey | IENDMAPPXAMKFM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |