C25H24ClN3O — CID 71704090
3-(4-chlorophenyl)-4-pyrrol-1-yl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one (PubChem CID 71704090) has the molecular formula C25H24ClN3O and a molecular weight of 417.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-pyrrol-1-yl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one.
| Compound Name | 3-(4-chlorophenyl)-4-pyrrol-1-yl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 71704090 |
| Molecular Formula | C25H24ClN3O |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-(4-chlorophenyl)-4-pyrrol-1-yl-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one |
| SMILES | O=C(CC(Cn1cccc1)c1ccc(Cl)cc1)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C25H24ClN3O/c26-20-9-7-18(8-10-20)19(16-28-12-3-4-13-28)15-25(30)29-14-11-22-21-5-1-2-6-23(21)27-24(22)17-29/h1-10,12-13,19,27H,11,14-17H2 |
| InChIKey | LXBSOFBARMSUNQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|