C21H18Cl3NO2 — CID 7171145
(3S)-6-tert-butyl-3,5-dichloro-1-(4-chlorophenyl)-3-phenylpyridine-2,4-dione (PubChem CID 7171145) has the molecular formula C21H18Cl3NO2 and a molecular weight of 422.74 g/mol. Its IUPAC name is (3S)-6-tert-butyl-3,5-dichloro-1-(4-chlorophenyl)-3-phenylpyridine-2,4-dione.
| Compound Name | (3S)-6-tert-butyl-3,5-dichloro-1-(4-chlorophenyl)-3-phenylpyridine-2,4-dione |
|---|---|
| PubChem CID | 7171145 |
| Molecular Formula | C21H18Cl3NO2 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | (3S)-6-tert-butyl-3,5-dichloro-1-(4-chlorophenyl)-3-phenylpyridine-2,4-dione |
| SMILES | CC(C)(C)C1=C(Cl)C(=O)[C@@](Cl)(c2ccccc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl3NO2/c1-20(2,3)17-16(23)18(26)21(24,13-7-5-4-6-8-13)19(27)25(17)15-11-9-14(22)10-12-15/h4-12H,1-3H3/t21-/m0/s1 |
| InChIKey | DJKWFDAABPEIBS-NRFANRHFSA-N |
| XLogP | 5.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|