C30H28F3N2O4PS — CID 7171152
1-[(R)-diphenoxyphosphoryl-(2-propoxyphenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 7171152) has the molecular formula C30H28F3N2O4PS and a molecular weight of 600.60 g/mol. Its IUPAC name is 1-[(R)-diphenoxyphosphoryl-(2-propoxyphenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(R)-diphenoxyphosphoryl-(2-propoxyphenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 7171152 |
| Molecular Formula | C30H28F3N2O4PS |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 1-[(R)-diphenoxyphosphoryl-(2-propoxyphenyl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCCOc1ccccc1[C@H](NC(=S)Nc1ccccc1C(F)(F)F)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C30H28F3N2O4PS/c1-2-21-37-27-20-12-9-17-24(27)28(35-29(41)34-26-19-11-10-18-25(26)30(31,32)33)40(36,38-22-13-5-3-6-14-22)39-23-15-7-4-8-16-23/h3-20,28H,2,21H2,1H3,(H2,34,35,41)/t28-/m1/s1 |
| InChIKey | RZWGFKYOGXAAGO-MUUNZHRXSA-N |
| XLogP | 8.83 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|