C22H22FNO4S — CID 71711644
2-[6-fluoro-3-methyl-4-[4-(propan-2-ylsulfamoyl)phenyl]naphthalen-2-yl]acetic acid (PubChem CID 71711644) has the molecular formula C22H22FNO4S and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[6-fluoro-3-methyl-4-[4-(propan-2-ylsulfamoyl)phenyl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-methyl-4-[4-(propan-2-ylsulfamoyl)phenyl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711644 |
| Molecular Formula | C22H22FNO4S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[6-fluoro-3-methyl-4-[4-(propan-2-ylsulfamoyl)phenyl]naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1-c1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C22H22FNO4S/c1-13(2)24-29(27,28)19-8-5-15(6-9-19)22-14(3)17(11-21(25)26)10-16-4-7-18(23)12-20(16)22/h4-10,12-13,24H,11H2,1-3H3,(H,25,26) |
| InChIKey | GXVLEZZXTLMHOF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |